C22H35NO2 — CID 156581201
N-[(Z,2S,3R)-3-hydroxy-1-phenyltetradec-9-en-2-yl]acetamide (PubChem CID 156581201) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is N-[(Z,2S,3R)-3-hydroxy-1-phenyltetradec-9-en-2-yl]acetamide.
| Compound Name | N-[(Z,2S,3R)-3-hydroxy-1-phenyltetradec-9-en-2-yl]acetamide |
|---|---|
| PubChem CID | 156581201 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | N-[(Z,2S,3R)-3-hydroxy-1-phenyltetradec-9-en-2-yl]acetamide |
| SMILES | CCCC/C=C\CCCCC[C@@H](O)[C@H](Cc1ccccc1)NC(C)=O |
| InChI | InChI=1S/C22H35NO2/c1-3-4-5-6-7-8-9-10-14-17-22(25)21(23-19(2)24)18-20-15-12-11-13-16-20/h6-7,11-13,15-16,21-22,25H,3-5,8-10,14,17-18H2,1-2H3,(H,23,24)/b7-6-/t21-,22+/m0/s1 |
| InChIKey | AYOJSPXYLNCMLY-HWEXMVQRSA-N |
| XLogP | 4.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|