C11H16O2 — CID 156581213
(2R,3S,4E)-2-[(1E)-buta-1,3-dienyl]-4-propylideneoxolan-3-ol (PubChem CID 156581213) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (2R,3S,4E)-2-[(1E)-buta-1,3-dienyl]-4-propylideneoxolan-3-ol.
| Compound Name | (2R,3S,4E)-2-[(1E)-buta-1,3-dienyl]-4-propylideneoxolan-3-ol |
|---|---|
| PubChem CID | 156581213 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (2R,3S,4E)-2-[(1E)-buta-1,3-dienyl]-4-propylideneoxolan-3-ol |
| SMILES | C=C/C=C/[C@H]1OC/C(=C\CC)[C@@H]1O |
| InChI | InChI=1S/C11H16O2/c1-3-5-7-10-11(12)9(6-4-2)8-13-10/h3,5-7,10-12H,1,4,8H2,2H3/b7-5+,9-6+/t10-,11+/m1/s1 |
| InChIKey | QUGCUUUDMULDGC-GCSFMYNSSA-N |
| XLogP | 1.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|