C11H18O2 — CID 156581216
(2S,4E,6E)-2-[(E)-prop-1-enyl]octa-4,6-diene-1,2-diol (PubChem CID 156581216) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (2S,4E,6E)-2-[(E)-prop-1-enyl]octa-4,6-diene-1,2-diol.
| Compound Name | (2S,4E,6E)-2-[(E)-prop-1-enyl]octa-4,6-diene-1,2-diol |
|---|---|
| PubChem CID | 156581216 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (2S,4E,6E)-2-[(E)-prop-1-enyl]octa-4,6-diene-1,2-diol |
| SMILES | C/C=C/C=C/C[C@](O)(/C=C/C)CO |
| InChI | InChI=1S/C11H18O2/c1-3-5-6-7-9-11(13,10-12)8-4-2/h3-8,12-13H,9-10H2,1-2H3/b5-3+,7-6+,8-4+/t11-/m1/s1 |
| InChIKey | OXRRGRAFJNBWTL-OKMSJDARSA-N |
| XLogP | 1.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|