C11H20O2 — CID 156581220
(2E,4E,7R)-2-propylocta-2,4-diene-1,7-diol (PubChem CID 156581220) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (2E,4E,7R)-2-propylocta-2,4-diene-1,7-diol.
| Compound Name | (2E,4E,7R)-2-propylocta-2,4-diene-1,7-diol |
|---|---|
| PubChem CID | 156581220 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (2E,4E,7R)-2-propylocta-2,4-diene-1,7-diol |
| SMILES | CCC/C(=C\C=C\C[C@@H](C)O)CO |
| InChI | InChI=1S/C11H20O2/c1-3-6-11(9-12)8-5-4-7-10(2)13/h4-5,8,10,12-13H,3,6-7,9H2,1-2H3/b5-4+,11-8+/t10-/m1/s1 |
| InChIKey | OEBABHXHOWUJNZ-FMRBXYKSSA-N |
| XLogP | 2.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|