C10H16O5 — CID 156581221
(1R,2R,3R,4R)-5-(hydroxymethyl)-6-[(E)-prop-1-enyl]cyclohex-5-ene-1,2,3,4-tetrol (PubChem CID 156581221) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is (1R,2R,3R,4R)-5-(hydroxymethyl)-6-[(E)-prop-1-enyl]cyclohex-5-ene-1,2,3,4-tetrol.
| Compound Name | (1R,2R,3R,4R)-5-(hydroxymethyl)-6-[(E)-prop-1-enyl]cyclohex-5-ene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 156581221 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (1R,2R,3R,4R)-5-(hydroxymethyl)-6-[(E)-prop-1-enyl]cyclohex-5-ene-1,2,3,4-tetrol |
| SMILES | C/C=C/C1=C(CO)[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H16O5/c1-2-3-5-6(4-11)8(13)10(15)9(14)7(5)12/h2-3,7-15H,4H2,1H3/b3-2+/t7-,8-,9-,10-/m1/s1 |
| InChIKey | CSBVPLTZWBYCDB-CXQZGVJDSA-N |
| XLogP | -1.69 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |