C19H30O2 — CID 156581283
(1S,5R,6R,9S,12R)-12-[(2R)-hexan-2-yl]-1,5-dimethyl-11-oxatricyclo[7.2.1.02,6]dodec-7-en-10-one (PubChem CID 156581283) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (1S,5R,6R,9S,12R)-12-[(2R)-hexan-2-yl]-1,5-dimethyl-11-oxatricyclo[7.2.1.02,6]dodec-7-en-10-one.
| Compound Name | (1S,5R,6R,9S,12R)-12-[(2R)-hexan-2-yl]-1,5-dimethyl-11-oxatricyclo[7.2.1.02,6]dodec-7-en-10-one |
|---|---|
| PubChem CID | 156581283 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (1S,5R,6R,9S,12R)-12-[(2R)-hexan-2-yl]-1,5-dimethyl-11-oxatricyclo[7.2.1.02,6]dodec-7-en-10-one |
| SMILES | CCCC[C@@H](C)[C@@H]1[C@@H]2C=C[C@@H]3C(CC[C@H]3C)[C@]1(C)OC2=O |
| InChI | InChI=1S/C19H30O2/c1-5-6-7-13(3)17-15-10-9-14-12(2)8-11-16(14)19(17,4)21-18(15)20/h9-10,12-17H,5-8,11H2,1-4H3/t12-,13-,14+,15+,16?,17-,19+/m1/s1 |
| InChIKey | AAIRYAMDKLMESQ-PIGIOJKNSA-N |
| XLogP | 4.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|