C15H20O3 — CID 156581337
(1aS,5S,7R,7aS,7bS)-5-hydroxy-1,1,4,7-tetramethyl-1a,2,5,7,7a,7b-hexahydrocyclopropa[e]azulene-3,6-dione (PubChem CID 156581337) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (1aS,5S,7R,7aS,7bS)-5-hydroxy-1,1,4,7-tetramethyl-1a,2,5,7,7a,7b-hexahydrocyclopropa[e]azulene-3,6-dione.
| Compound Name | (1aS,5S,7R,7aS,7bS)-5-hydroxy-1,1,4,7-tetramethyl-1a,2,5,7,7a,7b-hexahydrocyclopropa[e]azulene-3,6-dione |
|---|---|
| PubChem CID | 156581337 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (1aS,5S,7R,7aS,7bS)-5-hydroxy-1,1,4,7-tetramethyl-1a,2,5,7,7a,7b-hexahydrocyclopropa[e]azulene-3,6-dione |
| SMILES | CC1=C2[C@H](O)C(=O)[C@H](C)[C@@H]2[C@@H]2[C@H](CC1=O)C2(C)C |
| InChI | InChI=1S/C15H20O3/c1-6-9(16)5-8-12(15(8,3)4)10-7(2)13(17)14(18)11(6)10/h7-8,10,12,14,18H,5H2,1-4H3/t7-,8+,10+,12+,14+/m1/s1 |
| InChIKey | URVWKOSASHZFEO-BGUASBQGSA-N |
| XLogP | 1.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |