C23H34O8 — CID 156581399
6-[(E)-4-[(6S)-4-hydroxy-3-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]-5-oxo-2H-pyran-6-yl]-3-methylbut-2-enoyl]oxyhexanoic acid (PubChem CID 156581399) has the molecular formula C23H34O8 and a molecular weight of 438.52 g/mol. Its IUPAC name is 6-[(E)-4-[(6S)-4-hydroxy-3-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]-5-oxo-2H-pyran-6-yl]-3-methylbut-2-enoyl]oxyhexanoic acid.
| Compound Name | 6-[(E)-4-[(6S)-4-hydroxy-3-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]-5-oxo-2H-pyran-6-yl]-3-methylbut-2-enoyl]oxyhexanoic acid |
|---|---|
| PubChem CID | 156581399 |
| Molecular Formula | C23H34O8 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 6-[(E)-4-[(6S)-4-hydroxy-3-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]-5-oxo-2H-pyran-6-yl]-3-methylbut-2-enoyl]oxyhexanoic acid |
| SMILES | C/C(=C\C(=O)OCCCCCC(=O)O)C[C@@H]1OCC(C/C=C/[C@@H](C)[C@H](C)O)=C(O)C1=O |
| InChI | InChI=1S/C23H34O8/c1-15(13-21(27)30-11-6-4-5-10-20(25)26)12-19-23(29)22(28)18(14-31-19)9-7-8-16(2)17(3)24/h7-8,13,16-17,19,24,28H,4-6,9-12,14H2,1-3H3,(H,25,26)/b8-7+,15-13+/t16-,17+,19+/m1/s1 |
| InChIKey | OXYNOEAWWVRXNO-CQKYRUEOSA-N |
| XLogP | 3.25 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|