C14H14O5 — CID 156581407
2-(2,4-dimethyl-3-oxofuran-2-yl)-5-methoxy-3-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 156581407) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-(2,4-dimethyl-3-oxofuran-2-yl)-5-methoxy-3-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(2,4-dimethyl-3-oxofuran-2-yl)-5-methoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 156581407 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-(2,4-dimethyl-3-oxofuran-2-yl)-5-methoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | COC1=CC(=O)C(C2(C)OC=C(C)C2=O)=C(C)C1=O |
| InChI | InChI=1S/C14H14O5/c1-7-6-19-14(3,13(7)17)11-8(2)12(16)10(18-4)5-9(11)15/h5-6H,1-4H3 |
| InChIKey | QTXFUTOATGTAAH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|