About 6-[(E,4S)-4-hydroxypent-1-enyl]-3-methylpyran-2-one
6-[(E,4S)-4-hydroxypent-1-enyl]-3-methylpyran-2-one (PubChem CID 156581430) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 6-[(E,4S)-4-hydroxypent-1-enyl]-3-methylpyran-2-one.
Molecular Properties
| Compound Name | 6-[(E,4S)-4-hydroxypent-1-enyl]-3-methylpyran-2-one |
| PubChem CID | 156581430 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 6-[(E,4S)-4-hydroxypent-1-enyl]-3-methylpyran-2-one |
| SMILES | Cc1ccc(/C=C/C[C@H](C)O)oc1=O |
| InChI | InChI=1S/C11H14O3/c1-8-6-7-10(14-11(8)13)5-3-4-9(2)12/h3,5-7,9,12H,4H2,1-2H3/b5-3+/t9-/m0/s1 |
| InChIKey | KCGREIOHKFHTTO-SGRBOOSSSA-N |
| XLogP | 1.73 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(E,4S)-4-hydroxypent-1-enyl]-3-methylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(E,4S)-4-hydroxypent-1-enyl]-3-methylpyran-2-one?
The IUPAC name of 6-[(E,4S)-4-hydroxypent-1-enyl]-3-methylpyran-2-one (CID 156581430) is 6-[(E,4S)-4-hydroxypent-1-enyl]-3-methylpyran-2-one.
What is the SMILES notation for 6-[(E,4S)-4-hydroxypent-1-enyl]-3-methylpyran-2-one?
The canonical SMILES for 6-[(E,4S)-4-hydroxypent-1-enyl]-3-methylpyran-2-one is Cc1ccc(/C=C/C[C@H](C)O)oc1=O.
What is the InChIKey of 6-[(E,4S)-4-hydroxypent-1-enyl]-3-methylpyran-2-one?
The InChIKey is KCGREIOHKFHTTO-SGRBOOSSSA-N. The full InChI is InChI=1S/C11H14O3/c1-8-6-7-10(14-11(8)13)5-3-4-9(2)12/h3,5-7,9,12H,4H2,1-2H3/b5-3+/t9-/m0/s1.
What are the key properties of 6-[(E,4S)-4-hydroxypent-1-enyl]-3-methylpyran-2-one?
6-[(E,4S)-4-hydroxypent-1-enyl]-3-methylpyran-2-one has a molecular weight of 194.23 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(E,4S)-4-hydroxypent-1-enyl]-3-methylpyran-2-one is sourced from PubChem (CID 156581430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).