C22H23NO7 — CID 156581444
(1R,5R,7R,10S,11S,13R)-10-benzoyl-1-ethyl-11-hydroxy-10-methoxy-13-methyl-6-oxa-9-azadispiro[4.1.47.25]tridec-2-ene-4,8,12-trione (PubChem CID 156581444) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is (1R,5R,7R,10S,11S,13R)-10-benzoyl-1-ethyl-11-hydroxy-10-methoxy-13-methyl-6-oxa-9-azadispiro[4.1.47.25]tridec-2-ene-4,8,12-trione.
| Compound Name | (1R,5R,7R,10S,11S,13R)-10-benzoyl-1-ethyl-11-hydroxy-10-methoxy-13-methyl-6-oxa-9-azadispiro[4.1.47.25]tridec-2-ene-4,8,12-trione |
|---|---|
| PubChem CID | 156581444 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (1R,5R,7R,10S,11S,13R)-10-benzoyl-1-ethyl-11-hydroxy-10-methoxy-13-methyl-6-oxa-9-azadispiro[4.1.47.25]tridec-2-ene-4,8,12-trione |
| SMILES | CC[C@@H]1C=CC(=O)[C@@]12O[C@@]1(C(=O)N[C@@](OC)(C(=O)c3ccccc3)[C@H]1O)C(=O)[C@@H]2C |
| InChI | InChI=1S/C22H23NO7/c1-4-14-10-11-15(24)20(14)12(2)16(25)21(30-20)18(27)22(29-3,23-19(21)28)17(26)13-8-6-5-7-9-13/h5-12,14,18,27H,4H2,1-3H3,(H,23,28)/t12-,14+,18-,20-,21-,22+/m0/s1 |
| InChIKey | UUQBLSTUKNFCFG-MPIZLSOBSA-N |
| XLogP | 0.58 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|