C15H26O5 — CID 156581483
(2R,3R,4E,6E)-7-[(2S,3R,4S,5S)-3-hydroxy-4-methoxy-5-methyloxan-2-yl]octa-4,6-diene-2,3-diol (PubChem CID 156581483) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is (2R,3R,4E,6E)-7-[(2S,3R,4S,5S)-3-hydroxy-4-methoxy-5-methyloxan-2-yl]octa-4,6-diene-2,3-diol.
| Compound Name | (2R,3R,4E,6E)-7-[(2S,3R,4S,5S)-3-hydroxy-4-methoxy-5-methyloxan-2-yl]octa-4,6-diene-2,3-diol |
|---|---|
| PubChem CID | 156581483 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (2R,3R,4E,6E)-7-[(2S,3R,4S,5S)-3-hydroxy-4-methoxy-5-methyloxan-2-yl]octa-4,6-diene-2,3-diol |
| SMILES | CO[C@@H]1[C@@H](O)[C@H](/C(C)=C/C=C/[C@@H](O)[C@@H](C)O)OC[C@@H]1C |
| InChI | InChI=1S/C15H26O5/c1-9(6-5-7-12(17)11(3)16)15-13(18)14(19-4)10(2)8-20-15/h5-7,10-18H,8H2,1-4H3/b7-5+,9-6+/t10-,11+,12+,13+,14-,15-/m0/s1 |
| InChIKey | BDGNGHVEYFKBMY-QWQFJILDSA-N |
| XLogP | 0.64 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|