C36H56O5 — CID 156581532
3-pentyl-6-[(2R,4E,7E,10E,12E,15R,16R,17S,18E)-3,15,17-trihydroxy-4,8,10,12,16,18-hexamethylicosa-4,7,10,12,18-pentaen-2-yl]pyran-2-one (PubChem CID 156581532) has the molecular formula C36H56O5 and a molecular weight of 568.84 g/mol. Its IUPAC name is 3-pentyl-6-[(2R,4E,7E,10E,12E,15R,16R,17S,18E)-3,15,17-trihydroxy-4,8,10,12,16,18-hexamethylicosa-4,7,10,12,18-pentaen-2-yl]pyran-2-one.
| Compound Name | 3-pentyl-6-[(2R,4E,7E,10E,12E,15R,16R,17S,18E)-3,15,17-trihydroxy-4,8,10,12,16,18-hexamethylicosa-4,7,10,12,18-pentaen-2-yl]pyran-2-one |
|---|---|
| PubChem CID | 156581532 |
| Molecular Formula | C36H56O5 |
| Molecular Weight | 568.84 g/mol |
| Exact Mass | 568.41 |
| IUPAC Name | 3-pentyl-6-[(2R,4E,7E,10E,12E,15R,16R,17S,18E)-3,15,17-trihydroxy-4,8,10,12,16,18-hexamethylicosa-4,7,10,12,18-pentaen-2-yl]pyran-2-one |
| SMILES | C/C=C(\C)[C@@H](O)[C@H](C)[C@H](O)C/C=C(C)/C=C(\C)C/C(C)=C/C/C=C(\C)C(O)[C@@H](C)c1ccc(CCCCC)c(=O)o1 |
| InChI | InChI=1S/C36H56O5/c1-10-12-13-17-31-19-21-33(41-36(31)40)30(9)35(39)28(7)16-14-15-24(3)22-26(5)23-25(4)18-20-32(37)29(8)34(38)27(6)11-2/h11,15-16,18-19,21,23,29-30,32,34-35,37-39H,10,12-14,17,20,22H2,1-9H3/b24-15+,25-18+,26-23+,27-11+,28-16+/t29-,30+,32-,34-,35?/m1/s1 |
| InChIKey | UJCQIRRRRJVGBE-MBHWCTBHSA-N |
| XLogP | 8.12 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.84 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|