C20H14O6 — CID 156581539
(10S,11R)-7,10,15,19-tetrahydroxypentacyclo[10.7.1.02,11.03,8.016,20]icosa-1,3(8),4,6,12(20),13,15-heptaene-9,17-dione (PubChem CID 156581539) has the molecular formula C20H14O6 and a molecular weight of 350.33 g/mol. Its IUPAC name is (10S,11R)-7,10,15,19-tetrahydroxypentacyclo[10.7.1.02,11.03,8.016,20]icosa-1,3(8),4,6,12(20),13,15-heptaene-9,17-dione.
| Compound Name | (10S,11R)-7,10,15,19-tetrahydroxypentacyclo[10.7.1.02,11.03,8.016,20]icosa-1,3(8),4,6,12(20),13,15-heptaene-9,17-dione |
|---|---|
| PubChem CID | 156581539 |
| Molecular Formula | C20H14O6 |
| Molecular Weight | 350.33 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (10S,11R)-7,10,15,19-tetrahydroxypentacyclo[10.7.1.02,11.03,8.016,20]icosa-1,3(8),4,6,12(20),13,15-heptaene-9,17-dione |
| SMILES | O=C1CC(O)C2=C3c4cccc(O)c4C(=O)[C@@H](O)[C@@H]3c3ccc(O)c1c32 |
| InChI | InChI=1S/C20H14O6/c21-9-3-1-2-7-13(9)19(25)20(26)16-8-4-5-10(22)17-11(23)6-12(24)18(14(7)16)15(8)17/h1-5,12,16,20-22,24,26H,6H2/t12?,16-,20+/m1/s1 |
| InChIKey | NTUQETAZLLDXIV-GARHKUQKSA-N |
| XLogP | 1.61 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|