About methyl (E)-5,11-dihydroxydodec-2-enoate
methyl (E)-5,11-dihydroxydodec-2-enoate (PubChem CID 156581607) has the molecular formula C13H24O4
and a molecular weight of 244.33 g/mol. Its IUPAC name is methyl (E)-5,11-dihydroxydodec-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-5,11-dihydroxydodec-2-enoate |
| PubChem CID | 156581607 |
| Molecular Formula | C13H24O4 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.17 |
| IUPAC Name | methyl (E)-5,11-dihydroxydodec-2-enoate |
| SMILES | COC(=O)/C=C/CC(O)CCCCCC(C)O |
| InChI | InChI=1S/C13H24O4/c1-11(14)7-4-3-5-8-12(15)9-6-10-13(16)17-2/h6,10-12,14-15H,3-5,7-9H2,1-2H3/b10-6+ |
| InChIKey | YMVOPCVZPBIGSM-UXBLZVDNSA-N |
| XLogP | 1.80 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-5,11-dihydroxydodec-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-5,11-dihydroxydodec-2-enoate?
The IUPAC name of methyl (E)-5,11-dihydroxydodec-2-enoate (CID 156581607) is methyl (E)-5,11-dihydroxydodec-2-enoate.
What is the SMILES notation for methyl (E)-5,11-dihydroxydodec-2-enoate?
The canonical SMILES for methyl (E)-5,11-dihydroxydodec-2-enoate is COC(=O)/C=C/CC(O)CCCCCC(C)O.
What is the InChIKey of methyl (E)-5,11-dihydroxydodec-2-enoate?
The InChIKey is YMVOPCVZPBIGSM-UXBLZVDNSA-N. The full InChI is InChI=1S/C13H24O4/c1-11(14)7-4-3-5-8-12(15)9-6-10-13(16)17-2/h6,10-12,14-15H,3-5,7-9H2,1-2H3/b10-6+.
What are the key properties of methyl (E)-5,11-dihydroxydodec-2-enoate?
methyl (E)-5,11-dihydroxydodec-2-enoate has a molecular weight of 244.33 g/mol, XLogP of 1.80, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-5,11-dihydroxydodec-2-enoate is sourced from PubChem (CID 156581607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).