C13H24O2 — CID 156581629
(3E,7E)-4,8-dimethylundeca-3,7-diene-1,11-diol (PubChem CID 156581629) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (3E,7E)-4,8-dimethylundeca-3,7-diene-1,11-diol.
| Compound Name | (3E,7E)-4,8-dimethylundeca-3,7-diene-1,11-diol |
|---|---|
| PubChem CID | 156581629 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (3E,7E)-4,8-dimethylundeca-3,7-diene-1,11-diol |
| SMILES | C/C(=C\CCO)CC/C=C(\C)CCCO |
| InChI | InChI=1S/C13H24O2/c1-12(8-4-10-14)6-3-7-13(2)9-5-11-15/h6,9,14-15H,3-5,7-8,10-11H2,1-2H3/b12-6+,13-9+ |
| InChIKey | QKIBQVIRMUQLMR-IWFZMGPQSA-N |
| XLogP | 2.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|