C15H24O4 — CID 156581632
(1aR,2aS,3S,4R,5aS,7aR)-3,4-dihydroxy-5a,7a-dimethyl-3-propan-2-yl-1a,2,2a,4,5,6-hexahydroazuleno[5,6-b]oxiren-7-one (PubChem CID 156581632) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (1aR,2aS,3S,4R,5aS,7aR)-3,4-dihydroxy-5a,7a-dimethyl-3-propan-2-yl-1a,2,2a,4,5,6-hexahydroazuleno[5,6-b]oxiren-7-one.
| Compound Name | (1aR,2aS,3S,4R,5aS,7aR)-3,4-dihydroxy-5a,7a-dimethyl-3-propan-2-yl-1a,2,2a,4,5,6-hexahydroazuleno[5,6-b]oxiren-7-one |
|---|---|
| PubChem CID | 156581632 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (1aR,2aS,3S,4R,5aS,7aR)-3,4-dihydroxy-5a,7a-dimethyl-3-propan-2-yl-1a,2,2a,4,5,6-hexahydroazuleno[5,6-b]oxiren-7-one |
| SMILES | CC(C)[C@@]1(O)[C@H](O)C[C@@]2(C)CC(=O)[C@]3(C)O[C@@H]3C[C@@H]21 |
| InChI | InChI=1S/C15H24O4/c1-8(2)15(18)9-5-12-14(4,19-12)10(16)6-13(9,3)7-11(15)17/h8-9,11-12,17-18H,5-7H2,1-4H3/t9-,11+,12+,13+,14-,15-/m0/s1 |
| InChIKey | QXCSOGIPNMVPKI-BBSLFKGGSA-N |
| XLogP | 1.28 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|