C23H34O4 — CID 156581642
(5S,9R,10R,13S,14R,17S)-17-acetyl-3,3-dimethoxy-10,13-dimethyl-2,4,5,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one (PubChem CID 156581642) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is (5S,9R,10R,13S,14R,17S)-17-acetyl-3,3-dimethoxy-10,13-dimethyl-2,4,5,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one.
| Compound Name | (5S,9R,10R,13S,14R,17S)-17-acetyl-3,3-dimethoxy-10,13-dimethyl-2,4,5,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
|---|---|
| PubChem CID | 156581642 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (5S,9R,10R,13S,14R,17S)-17-acetyl-3,3-dimethoxy-10,13-dimethyl-2,4,5,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| SMILES | COC1(OC)CC[C@@]2(C)[C@H](C1)C(=O)C=C1[C@@H]2CC[C@]2(C)[C@@H](C(C)=O)CC[C@@H]12 |
| InChI | InChI=1S/C23H34O4/c1-14(24)16-6-7-17-15-12-20(25)19-13-23(26-4,27-5)11-10-22(19,3)18(15)8-9-21(16,17)2/h12,16-19H,6-11,13H2,1-5H3/t16-,17+,18+,19-,21-,22-/m1/s1 |
| InChIKey | AXWFOQMABDNGAW-UQXDBHSJSA-N |
| XLogP | 4.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|