C15H24O2 — CID 156581651
(4S,4aR,6S,8aS)-4,4a-dimethyl-6-propan-2-yl-3,4,5,6,8,8a-hexahydro-2H-naphthalene-1,7-dione (PubChem CID 156581651) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (4S,4aR,6S,8aS)-4,4a-dimethyl-6-propan-2-yl-3,4,5,6,8,8a-hexahydro-2H-naphthalene-1,7-dione.
| Compound Name | (4S,4aR,6S,8aS)-4,4a-dimethyl-6-propan-2-yl-3,4,5,6,8,8a-hexahydro-2H-naphthalene-1,7-dione |
|---|---|
| PubChem CID | 156581651 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (4S,4aR,6S,8aS)-4,4a-dimethyl-6-propan-2-yl-3,4,5,6,8,8a-hexahydro-2H-naphthalene-1,7-dione |
| SMILES | CC(C)[C@@H]1C[C@@]2(C)[C@H](CC1=O)C(=O)CC[C@@H]2C |
| InChI | InChI=1S/C15H24O2/c1-9(2)11-8-15(4)10(3)5-6-13(16)12(15)7-14(11)17/h9-12H,5-8H2,1-4H3/t10-,11-,12+,15+/m0/s1 |
| InChIKey | RORXDJQKHFUGBV-UUIJZJDISA-N |
| XLogP | 3.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |