C15H24O3 — CID 156581653
(3R,4R,4aR,6S,8aS)-3-hydroxy-4,4a-dimethyl-6-propan-2-yl-3,4,5,6,8,8a-hexahydro-2H-naphthalene-1,7-dione (PubChem CID 156581653) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (3R,4R,4aR,6S,8aS)-3-hydroxy-4,4a-dimethyl-6-propan-2-yl-3,4,5,6,8,8a-hexahydro-2H-naphthalene-1,7-dione.
| Compound Name | (3R,4R,4aR,6S,8aS)-3-hydroxy-4,4a-dimethyl-6-propan-2-yl-3,4,5,6,8,8a-hexahydro-2H-naphthalene-1,7-dione |
|---|---|
| PubChem CID | 156581653 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (3R,4R,4aR,6S,8aS)-3-hydroxy-4,4a-dimethyl-6-propan-2-yl-3,4,5,6,8,8a-hexahydro-2H-naphthalene-1,7-dione |
| SMILES | CC(C)[C@@H]1C[C@@]2(C)[C@H](CC1=O)C(=O)C[C@@H](O)[C@@H]2C |
| InChI | InChI=1S/C15H24O3/c1-8(2)10-7-15(4)9(3)12(16)6-14(18)11(15)5-13(10)17/h8-12,16H,5-7H2,1-4H3/t9-,10-,11+,12+,15+/m0/s1 |
| InChIKey | UBRWQSQZRBKSND-HHHUMZEGSA-N |
| XLogP | 2.21 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |