C21H34O2 — CID 156581677
(4E,6R,8E,11R,12R)-6-methoxy-4,8,14,15,15-pentamethylbicyclo[9.3.1]pentadeca-1(14),4,8-trien-12-ol (PubChem CID 156581677) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is (4E,6R,8E,11R,12R)-6-methoxy-4,8,14,15,15-pentamethylbicyclo[9.3.1]pentadeca-1(14),4,8-trien-12-ol.
| Compound Name | (4E,6R,8E,11R,12R)-6-methoxy-4,8,14,15,15-pentamethylbicyclo[9.3.1]pentadeca-1(14),4,8-trien-12-ol |
|---|---|
| PubChem CID | 156581677 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (4E,6R,8E,11R,12R)-6-methoxy-4,8,14,15,15-pentamethylbicyclo[9.3.1]pentadeca-1(14),4,8-trien-12-ol |
| SMILES | CO[C@H]1/C=C(\C)CCC2=C(C)C[C@@H](O)[C@H](C/C=C(\C)C1)C2(C)C |
| InChI | InChI=1S/C21H34O2/c1-14-7-9-18-16(3)13-20(22)19(21(18,4)5)10-8-15(2)12-17(11-14)23-6/h8,11,17,19-20,22H,7,9-10,12-13H2,1-6H3/b14-11+,15-8+/t17-,19-,20+/m0/s1 |
| InChIKey | XTOYFHPYGQZMOS-WJZCTMFHSA-N |
| XLogP | 5.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|