C26H38O7 — CID 156581773
methyl 3-[(1R,2S,5S,6S,7S,9R,11R,12R)-11-hydroxy-5-(2-hydroxypropan-2-yl)-2,6,9,12-tetramethyl-15-methylidene-10,14-dioxo-13-oxatetracyclo[7.5.1.01,11.02,7]pentadecan-6-yl]propanoate (PubChem CID 156581773) has the molecular formula C26H38O7 and a molecular weight of 462.58 g/mol. Its IUPAC name is methyl 3-[(1R,2S,5S,6S,7S,9R,11R,12R)-11-hydroxy-5-(2-hydroxypropan-2-yl)-2,6,9,12-tetramethyl-15-methylidene-10,14-dioxo-13-oxatetracyclo[7.5.1.01,11.02,7]pentadecan-6-yl]propanoate.
| Compound Name | methyl 3-[(1R,2S,5S,6S,7S,9R,11R,12R)-11-hydroxy-5-(2-hydroxypropan-2-yl)-2,6,9,12-tetramethyl-15-methylidene-10,14-dioxo-13-oxatetracyclo[7.5.1.01,11.02,7]pentadecan-6-yl]propanoate |
|---|---|
| PubChem CID | 156581773 |
| Molecular Formula | C26H38O7 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | methyl 3-[(1R,2S,5S,6S,7S,9R,11R,12R)-11-hydroxy-5-(2-hydroxypropan-2-yl)-2,6,9,12-tetramethyl-15-methylidene-10,14-dioxo-13-oxatetracyclo[7.5.1.01,11.02,7]pentadecan-6-yl]propanoate |
| SMILES | C=C1[C@@]2(C)C[C@H]3[C@](C)(CCC(=O)OC)[C@@H](C(C)(C)O)CC[C@]3(C)[C@@]13C(=O)O[C@H](C)[C@@]3(O)C2=O |
| InChI | InChI=1S/C26H38O7/c1-14-23(6)13-17-22(5,11-10-18(27)32-8)16(21(3,4)30)9-12-24(17,7)25(14)20(29)33-15(2)26(25,31)19(23)28/h15-17,30-31H,1,9-13H2,2-8H3/t15-,16-,17+,22-,23-,24+,25+,26-/m1/s1 |
| InChIKey | DZWRLKXOLCEPOT-UAURMHOTSA-N |
| XLogP | 2.96 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|