C15H22O3 — CID 156581847
(2aR,4aS,6R,7aS,7bR)-3-(hydroxymethyl)-6,7b-dimethyl-2,2a,4a,5,7,7a-hexahydro-1H-cyclobuta[e]indene-6-carboxylic acid (PubChem CID 156581847) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2aR,4aS,6R,7aS,7bR)-3-(hydroxymethyl)-6,7b-dimethyl-2,2a,4a,5,7,7a-hexahydro-1H-cyclobuta[e]indene-6-carboxylic acid.
| Compound Name | (2aR,4aS,6R,7aS,7bR)-3-(hydroxymethyl)-6,7b-dimethyl-2,2a,4a,5,7,7a-hexahydro-1H-cyclobuta[e]indene-6-carboxylic acid |
|---|---|
| PubChem CID | 156581847 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (2aR,4aS,6R,7aS,7bR)-3-(hydroxymethyl)-6,7b-dimethyl-2,2a,4a,5,7,7a-hexahydro-1H-cyclobuta[e]indene-6-carboxylic acid |
| SMILES | C[C@@]1(C(=O)O)C[C@H]2C=C(CO)[C@@H]3CC[C@]3(C)[C@H]2C1 |
| InChI | InChI=1S/C15H22O3/c1-14(13(17)18)6-9-5-10(8-16)11-3-4-15(11,2)12(9)7-14/h5,9,11-12,16H,3-4,6-8H2,1-2H3,(H,17,18)/t9-,11+,12+,14-,15+/m1/s1 |
| InChIKey | HOGVSEXZFBBVKH-ONAWRNRTSA-N |
| XLogP | 2.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|