C25H32Cl2O7 — CID 156581867
(3R,4aR,10aR)-3-chloro-10a-[[(1S,3S,6S)-3-chloro-6-hydroxy-2,2,6-trimethylcyclohexyl]methyl]-4a,6,8-trihydroxy-2,2-dimethyl-3,4-dihydrobenzo[g]chromene-5,10-dione (PubChem CID 156581867) has the molecular formula C25H32Cl2O7 and a molecular weight of 515.43 g/mol. Its IUPAC name is (3R,4aR,10aR)-3-chloro-10a-[[(1S,3S,6S)-3-chloro-6-hydroxy-2,2,6-trimethylcyclohexyl]methyl]-4a,6,8-trihydroxy-2,2-dimethyl-3,4-dihydrobenzo[g]chromene-5,10-dione.
| Compound Name | (3R,4aR,10aR)-3-chloro-10a-[[(1S,3S,6S)-3-chloro-6-hydroxy-2,2,6-trimethylcyclohexyl]methyl]-4a,6,8-trihydroxy-2,2-dimethyl-3,4-dihydrobenzo[g]chromene-5,10-dione |
|---|---|
| PubChem CID | 156581867 |
| Molecular Formula | C25H32Cl2O7 |
| Molecular Weight | 515.43 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | (3R,4aR,10aR)-3-chloro-10a-[[(1S,3S,6S)-3-chloro-6-hydroxy-2,2,6-trimethylcyclohexyl]methyl]-4a,6,8-trihydroxy-2,2-dimethyl-3,4-dihydrobenzo[g]chromene-5,10-dione |
| SMILES | CC1(C)O[C@@]2(C[C@H]3C(C)(C)[C@@H](Cl)CC[C@]3(C)O)C(=O)c3cc(O)cc(O)c3C(=O)[C@@]2(O)C[C@H]1Cl |
| InChI | InChI=1S/C25H32Cl2O7/c1-21(2)15(23(5,32)7-6-16(21)26)10-25-19(30)13-8-12(28)9-14(29)18(13)20(31)24(25,33)11-17(27)22(3,4)34-25/h8-9,15-17,28-29,32-33H,6-7,10-11H2,1-5H3/t15-,16-,17+,23-,24-,25-/m0/s1 |
| InChIKey | BLPXOZCSIARXAT-VTQDYBALSA-N |
| XLogP | 3.94 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|