C12H20O4 — CID 156581880
(3S,4R,5S,8R)-3-propyl-3,4,5,6,7,8-hexahydro-1H-isochromene-4,5,8-triol (PubChem CID 156581880) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (3S,4R,5S,8R)-3-propyl-3,4,5,6,7,8-hexahydro-1H-isochromene-4,5,8-triol.
| Compound Name | (3S,4R,5S,8R)-3-propyl-3,4,5,6,7,8-hexahydro-1H-isochromene-4,5,8-triol |
|---|---|
| PubChem CID | 156581880 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (3S,4R,5S,8R)-3-propyl-3,4,5,6,7,8-hexahydro-1H-isochromene-4,5,8-triol |
| SMILES | CCC[C@@H]1OCC2=C([C@H]1O)[C@@H](O)CC[C@H]2O |
| InChI | InChI=1S/C12H20O4/c1-2-3-10-12(15)11-7(6-16-10)8(13)4-5-9(11)14/h8-10,12-15H,2-6H2,1H3/t8-,9+,10+,12+/m1/s1 |
| InChIKey | SYHQBGLUCBOBKM-WDCWCFNPSA-N |
| XLogP | 0.36 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|