C12H16O3 — CID 156581881
(3S,4R)-3-propyl-3,4-dihydro-1H-isochromene-4,8-diol (PubChem CID 156581881) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (3S,4R)-3-propyl-3,4-dihydro-1H-isochromene-4,8-diol.
| Compound Name | (3S,4R)-3-propyl-3,4-dihydro-1H-isochromene-4,8-diol |
|---|---|
| PubChem CID | 156581881 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (3S,4R)-3-propyl-3,4-dihydro-1H-isochromene-4,8-diol |
| SMILES | CCC[C@@H]1OCc2c(O)cccc2[C@H]1O |
| InChI | InChI=1S/C12H16O3/c1-2-4-11-12(14)8-5-3-6-10(13)9(8)7-15-11/h3,5-6,11-14H,2,4,7H2,1H3/t11-,12+/m0/s1 |
| InChIKey | AKYGUIAKZFCMSM-NWDGAFQWSA-N |
| XLogP | 2.12 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |