C19H32O5 — CID 156581905
(3R,4aS,6S,8aR)-7-hept-1-enyl-8-(hydroxymethyl)-2,2-dimethyl-4,5,6,8a-tetrahydro-3H-chromene-3,4a,6-triol (PubChem CID 156581905) has the molecular formula C19H32O5 and a molecular weight of 340.46 g/mol. Its IUPAC name is (3R,4aS,6S,8aR)-7-hept-1-enyl-8-(hydroxymethyl)-2,2-dimethyl-4,5,6,8a-tetrahydro-3H-chromene-3,4a,6-triol.
| Compound Name | (3R,4aS,6S,8aR)-7-hept-1-enyl-8-(hydroxymethyl)-2,2-dimethyl-4,5,6,8a-tetrahydro-3H-chromene-3,4a,6-triol |
|---|---|
| PubChem CID | 156581905 |
| Molecular Formula | C19H32O5 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (3R,4aS,6S,8aR)-7-hept-1-enyl-8-(hydroxymethyl)-2,2-dimethyl-4,5,6,8a-tetrahydro-3H-chromene-3,4a,6-triol |
| SMILES | CCCCCC=CC1=C(CO)[C@H]2OC(C)(C)[C@H](O)C[C@@]2(O)C[C@@H]1O |
| InChI | InChI=1S/C19H32O5/c1-4-5-6-7-8-9-13-14(12-20)17-19(23,10-15(13)21)11-16(22)18(2,3)24-17/h8-9,15-17,20-23H,4-7,10-12H2,1-3H3/t15-,16+,17+,19-/m0/s1 |
| InChIKey | QHVWABKEGKWMSX-FAJBIJEISA-N |
| XLogP | 1.84 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|