About (3R,6S)-3-methyl-6-[(2S,6R)-6-methyl-7-oxooctan-2-yl]oxan-2-one
(3R,6S)-3-methyl-6-[(2S,6R)-6-methyl-7-oxooctan-2-yl]oxan-2-one (PubChem CID 156581947) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is (3R,6S)-3-methyl-6-[(2S,6R)-6-methyl-7-oxooctan-2-yl]oxan-2-one.
Molecular Properties
| Compound Name | (3R,6S)-3-methyl-6-[(2S,6R)-6-methyl-7-oxooctan-2-yl]oxan-2-one |
| PubChem CID | 156581947 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (3R,6S)-3-methyl-6-[(2S,6R)-6-methyl-7-oxooctan-2-yl]oxan-2-one |
| SMILES | CC(=O)[C@H](C)CCC[C@H](C)[C@@H]1CC[C@@H](C)C(=O)O1 |
| InChI | InChI=1S/C15H26O3/c1-10(13(4)16)6-5-7-11(2)14-9-8-12(3)15(17)18-14/h10-12,14H,5-9H2,1-4H3/t10-,11+,12-,14+/m1/s1 |
| InChIKey | RSGFRHWBQXHHQQ-CZXHOFHRSA-N |
| XLogP | 3.36 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,6S)-3-methyl-6-[(2S,6R)-6-methyl-7-oxooctan-2-yl]oxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,6S)-3-methyl-6-[(2S,6R)-6-methyl-7-oxooctan-2-yl]oxan-2-one?
The IUPAC name of (3R,6S)-3-methyl-6-[(2S,6R)-6-methyl-7-oxooctan-2-yl]oxan-2-one (CID 156581947) is (3R,6S)-3-methyl-6-[(2S,6R)-6-methyl-7-oxooctan-2-yl]oxan-2-one.
What is the SMILES notation for (3R,6S)-3-methyl-6-[(2S,6R)-6-methyl-7-oxooctan-2-yl]oxan-2-one?
The canonical SMILES for (3R,6S)-3-methyl-6-[(2S,6R)-6-methyl-7-oxooctan-2-yl]oxan-2-one is CC(=O)[C@H](C)CCC[C@H](C)[C@@H]1CC[C@@H](C)C(=O)O1.
What is the InChIKey of (3R,6S)-3-methyl-6-[(2S,6R)-6-methyl-7-oxooctan-2-yl]oxan-2-one?
The InChIKey is RSGFRHWBQXHHQQ-CZXHOFHRSA-N. The full InChI is InChI=1S/C15H26O3/c1-10(13(4)16)6-5-7-11(2)14-9-8-12(3)15(17)18-14/h10-12,14H,5-9H2,1-4H3/t10-,11+,12-,14+/m1/s1.
What are the key properties of (3R,6S)-3-methyl-6-[(2S,6R)-6-methyl-7-oxooctan-2-yl]oxan-2-one?
(3R,6S)-3-methyl-6-[(2S,6R)-6-methyl-7-oxooctan-2-yl]oxan-2-one has a molecular weight of 254.37 g/mol, XLogP of 3.36, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,6S)-3-methyl-6-[(2S,6R)-6-methyl-7-oxooctan-2-yl]oxan-2-one is sourced from PubChem (CID 156581947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).