C16H22O4 — CID 156581957
(4R,5R)-4-hydroxy-3,3,5-trimethyl-5-(6-methyl-7-oxoocta-1,3,5-trienyl)oxolan-2-one (PubChem CID 156581957) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (4R,5R)-4-hydroxy-3,3,5-trimethyl-5-(6-methyl-7-oxoocta-1,3,5-trienyl)oxolan-2-one.
| Compound Name | (4R,5R)-4-hydroxy-3,3,5-trimethyl-5-(6-methyl-7-oxoocta-1,3,5-trienyl)oxolan-2-one |
|---|---|
| PubChem CID | 156581957 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (4R,5R)-4-hydroxy-3,3,5-trimethyl-5-(6-methyl-7-oxoocta-1,3,5-trienyl)oxolan-2-one |
| SMILES | CC(=O)C(C)=CC=CC=C[C@@]1(C)OC(=O)C(C)(C)[C@H]1O |
| InChI | InChI=1S/C16H22O4/c1-11(12(2)17)9-7-6-8-10-16(5)13(18)15(3,4)14(19)20-16/h6-10,13,18H,1-5H3/t13-,16-/m1/s1 |
| InChIKey | ZTCKHTJXEMMWGV-CZUORRHYSA-N |
| XLogP | 2.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|