About 4-ethoxy-4,6-dihydrofuro[3,2-c]pyran-2-one
4-ethoxy-4,6-dihydrofuro[3,2-c]pyran-2-one (PubChem CID 156581969) has the molecular formula C9H10O4
and a molecular weight of 182.17 g/mol. Its IUPAC name is 4-ethoxy-4,6-dihydrofuro[3,2-c]pyran-2-one.
Molecular Properties
| Compound Name | 4-ethoxy-4,6-dihydrofuro[3,2-c]pyran-2-one |
| PubChem CID | 156581969 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 4-ethoxy-4,6-dihydrofuro[3,2-c]pyran-2-one |
| SMILES | CCOC1OCC=C2OC(=O)C=C21 |
| InChI | InChI=1S/C9H10O4/c1-2-11-9-6-5-8(10)13-7(6)3-4-12-9/h3,5,9H,2,4H2,1H3 |
| InChIKey | WRKXOSFEDIZBRU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethoxy-4,6-dihydrofuro[3,2-c]pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-4,6-dihydrofuro[3,2-c]pyran-2-one?
The IUPAC name of 4-ethoxy-4,6-dihydrofuro[3,2-c]pyran-2-one (CID 156581969) is 4-ethoxy-4,6-dihydrofuro[3,2-c]pyran-2-one.
What is the SMILES notation for 4-ethoxy-4,6-dihydrofuro[3,2-c]pyran-2-one?
The canonical SMILES for 4-ethoxy-4,6-dihydrofuro[3,2-c]pyran-2-one is CCOC1OCC=C2OC(=O)C=C21.
What is the InChIKey of 4-ethoxy-4,6-dihydrofuro[3,2-c]pyran-2-one?
The InChIKey is WRKXOSFEDIZBRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4/c1-2-11-9-6-5-8(10)13-7(6)3-4-12-9/h3,5,9H,2,4H2,1H3.
What are the key properties of 4-ethoxy-4,6-dihydrofuro[3,2-c]pyran-2-one?
4-ethoxy-4,6-dihydrofuro[3,2-c]pyran-2-one has a molecular weight of 182.17 g/mol, XLogP of 0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-4,6-dihydrofuro[3,2-c]pyran-2-one is sourced from PubChem (CID 156581969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).