C24H36O6 — CID 156581987
2-[(4aS,5R,8aR)-5-(acetyloxymethyl)-2-(4-acetyloxy-2-methylbut-2-enyl)-5,8a-dimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]acetic acid (PubChem CID 156581987) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is 2-[(4aS,5R,8aR)-5-(acetyloxymethyl)-2-(4-acetyloxy-2-methylbut-2-enyl)-5,8a-dimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]acetic acid.
| Compound Name | 2-[(4aS,5R,8aR)-5-(acetyloxymethyl)-2-(4-acetyloxy-2-methylbut-2-enyl)-5,8a-dimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]acetic acid |
|---|---|
| PubChem CID | 156581987 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 2-[(4aS,5R,8aR)-5-(acetyloxymethyl)-2-(4-acetyloxy-2-methylbut-2-enyl)-5,8a-dimethyl-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]acetic acid |
| SMILES | CC(=O)OCC=C(C)CC1=C(CC(=O)O)[C@]2(C)CCC[C@@](C)(COC(C)=O)[C@H]2CC1 |
| InChI | InChI=1S/C24H36O6/c1-16(9-12-29-17(2)25)13-19-7-8-21-23(4,15-30-18(3)26)10-6-11-24(21,5)20(19)14-22(27)28/h9,21H,6-8,10-15H2,1-5H3,(H,27,28)/t21-,23+,24+/m1/s1 |
| InChIKey | PZPSBQQUTMPFKA-NHTMILBNSA-N |
| XLogP | 4.83 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|