C15H26O3 — CID 156582076
(E,3R)-6-[(1S,5R)-5-hydroxy-2-methylidenecyclohexyl]-2-methylhept-5-ene-2,3-diol (PubChem CID 156582076) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (E,3R)-6-[(1S,5R)-5-hydroxy-2-methylidenecyclohexyl]-2-methylhept-5-ene-2,3-diol.
| Compound Name | (E,3R)-6-[(1S,5R)-5-hydroxy-2-methylidenecyclohexyl]-2-methylhept-5-ene-2,3-diol |
|---|---|
| PubChem CID | 156582076 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (E,3R)-6-[(1S,5R)-5-hydroxy-2-methylidenecyclohexyl]-2-methylhept-5-ene-2,3-diol |
| SMILES | C=C1CC[C@@H](O)C[C@@H]1/C(C)=C/C[C@@H](O)C(C)(C)O |
| InChI | InChI=1S/C15H26O3/c1-10-5-7-12(16)9-13(10)11(2)6-8-14(17)15(3,4)18/h6,12-14,16-18H,1,5,7-9H2,2-4H3/b11-6+/t12-,13+,14-/m1/s1 |
| InChIKey | VZIOVTDSUZMNTE-NZQFFHFTSA-N |
| XLogP | 2.17 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|