C19H30O6 — CID 156582260
(1R,3S,4S,4aR,5S,6S,8aS)-1-[(1Z,3Z)-5-hydroxy-6-methylocta-1,3-dienyl]-3-methyl-1,4,4a,5,6,8a-hexahydroisochromene-3,4,5,6-tetrol (PubChem CID 156582260) has the molecular formula C19H30O6 and a molecular weight of 354.44 g/mol. Its IUPAC name is (1R,3S,4S,4aR,5S,6S,8aS)-1-[(1Z,3Z)-5-hydroxy-6-methylocta-1,3-dienyl]-3-methyl-1,4,4a,5,6,8a-hexahydroisochromene-3,4,5,6-tetrol.
| Compound Name | (1R,3S,4S,4aR,5S,6S,8aS)-1-[(1Z,3Z)-5-hydroxy-6-methylocta-1,3-dienyl]-3-methyl-1,4,4a,5,6,8a-hexahydroisochromene-3,4,5,6-tetrol |
|---|---|
| PubChem CID | 156582260 |
| Molecular Formula | C19H30O6 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | (1R,3S,4S,4aR,5S,6S,8aS)-1-[(1Z,3Z)-5-hydroxy-6-methylocta-1,3-dienyl]-3-methyl-1,4,4a,5,6,8a-hexahydroisochromene-3,4,5,6-tetrol |
| SMILES | CCC(C)C(O)/C=C\C=C/[C@H]1O[C@](C)(O)[C@@H](O)[C@H]2[C@H](O)[C@@H](O)C=C[C@@H]21 |
| InChI | InChI=1S/C19H30O6/c1-4-11(2)13(20)7-5-6-8-15-12-9-10-14(21)17(22)16(12)18(23)19(3,24)25-15/h5-18,20-24H,4H2,1-3H3/b7-5-,8-6-/t11?,12-,13?,14+,15-,16-,17-,18+,19+/m1/s1 |
| InChIKey | NIGLUNSGMCEPLF-BQNSCZRNSA-N |
| XLogP | 0.50 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|