C19H26N2O6 — CID 156582322
[(2R,3R,4S,5R,6S)-3,5-diacetamido-2-methyl-6-phenylmethoxyoxan-4-yl] acetate (PubChem CID 156582322) has the molecular formula C19H26N2O6 and a molecular weight of 378.43 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,5-diacetamido-2-methyl-6-phenylmethoxyoxan-4-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,5-diacetamido-2-methyl-6-phenylmethoxyoxan-4-yl] acetate |
|---|---|
| PubChem CID | 156582322 |
| Molecular Formula | C19H26N2O6 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,5-diacetamido-2-methyl-6-phenylmethoxyoxan-4-yl] acetate |
| SMILES | CC(=O)N[C@H]1[C@@H](OCc2ccccc2)O[C@H](C)[C@@H](NC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H26N2O6/c1-11-16(20-12(2)22)18(27-14(4)24)17(21-13(3)23)19(26-11)25-10-15-8-6-5-7-9-15/h5-9,11,16-19H,10H2,1-4H3,(H,20,22)(H,21,23)/t11-,16-,17-,18+,19+/m1/s1 |
| InChIKey | PMFBAYZWSDMPQZ-ADRLOPMBSA-N |
| XLogP | 0.89 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |