C28H46O5 — CID 156582328
(4R,7S,8R,11S,12S)-4,8-dihydroxy-12-[(6S,8Z,10S,11S)-11-hydroxy-6,10-dimethyltrideca-2,4,8-trien-2-yl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one (PubChem CID 156582328) has the molecular formula C28H46O5 and a molecular weight of 462.67 g/mol. Its IUPAC name is (4R,7S,8R,11S,12S)-4,8-dihydroxy-12-[(6S,8Z,10S,11S)-11-hydroxy-6,10-dimethyltrideca-2,4,8-trien-2-yl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one.
| Compound Name | (4R,7S,8R,11S,12S)-4,8-dihydroxy-12-[(6S,8Z,10S,11S)-11-hydroxy-6,10-dimethyltrideca-2,4,8-trien-2-yl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 156582328 |
| Molecular Formula | C28H46O5 |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.33 |
| IUPAC Name | (4R,7S,8R,11S,12S)-4,8-dihydroxy-12-[(6S,8Z,10S,11S)-11-hydroxy-6,10-dimethyltrideca-2,4,8-trien-2-yl]-7,11-dimethyl-1-oxacyclododec-9-en-2-one |
| SMILES | CC[C@H](O)[C@@H](C)/C=C\C[C@H](C)C=CC=C(C)[C@H]1OC(=O)C[C@H](O)CC[C@H](C)[C@@H](O)C=C[C@@H]1C |
| InChI | InChI=1S/C28H46O5/c1-7-25(30)20(3)12-8-10-19(2)11-9-13-22(5)28-23(6)15-17-26(31)21(4)14-16-24(29)18-27(32)33-28/h8-9,11-13,15,17,19-21,23-26,28-31H,7,10,14,16,18H2,1-6H3/b11-9?,12-8-,17-15?,22-13?/t19-,20-,21-,23-,24+,25-,26-,28+/m0/s1 |
| InChIKey | BGWOHCNZOGFLGX-RNDOXKLLSA-N |
| XLogP | 5.12 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|