C30H48O6 — CID 156582330
[(2S,3S,6R,7S,10R)-10-hydroxy-2-[(6S,8Z,10S,11S)-11-hydroxy-6,10-dimethyltrideca-2,4,8-trien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 156582330) has the molecular formula C30H48O6 and a molecular weight of 504.71 g/mol. Its IUPAC name is [(2S,3S,6R,7S,10R)-10-hydroxy-2-[(6S,8Z,10S,11S)-11-hydroxy-6,10-dimethyltrideca-2,4,8-trien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(2S,3S,6R,7S,10R)-10-hydroxy-2-[(6S,8Z,10S,11S)-11-hydroxy-6,10-dimethyltrideca-2,4,8-trien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 156582330 |
| Molecular Formula | C30H48O6 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.35 |
| IUPAC Name | [(2S,3S,6R,7S,10R)-10-hydroxy-2-[(6S,8Z,10S,11S)-11-hydroxy-6,10-dimethyltrideca-2,4,8-trien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CC[C@H](O)[C@@H](C)/C=C\C[C@H](C)C=CC=C(C)[C@H]1OC(=O)C[C@H](O)CC[C@H](C)[C@@H](OC(C)=O)C=C[C@@H]1C |
| InChI | InChI=1S/C30H48O6/c1-8-27(33)21(3)13-9-11-20(2)12-10-14-23(5)30-24(6)16-18-28(35-25(7)31)22(4)15-17-26(32)19-29(34)36-30/h9-10,12-14,16,18,20-22,24,26-28,30,32-33H,8,11,15,17,19H2,1-7H3/b12-10?,13-9-,18-16?,23-14?/t20-,21-,22-,24-,26+,27-,28-,30+/m0/s1 |
| InChIKey | IJLRYMBRHYOROZ-XYMWPTNKSA-N |
| XLogP | 5.70 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|