C22H28O8 — CID 156582340
(2R,11R)-11-butyl-9,10-dihydroxy-2-pentyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone (PubChem CID 156582340) has the molecular formula C22H28O8 and a molecular weight of 420.46 g/mol. Its IUPAC name is (2R,11R)-11-butyl-9,10-dihydroxy-2-pentyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone.
| Compound Name | (2R,11R)-11-butyl-9,10-dihydroxy-2-pentyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone |
|---|---|
| PubChem CID | 156582340 |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (2R,11R)-11-butyl-9,10-dihydroxy-2-pentyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone |
| SMILES | CCCCC[C@@H]1CC2=C(C(=O)OC2=O)C(O)C(O)[C@H](CCCC)C2=C1C(=O)OC2=O |
| InChI | InChI=1S/C22H28O8/c1-3-5-7-8-11-10-13-16(22(28)29-19(13)25)18(24)17(23)12(9-6-4-2)15-14(11)20(26)30-21(15)27/h11-12,17-18,23-24H,3-10H2,1-2H3/t11-,12-,17?,18?/m1/s1 |
| InChIKey | VRKQCCPMCHSMDB-SKLAPFLYSA-N |
| XLogP | 1.87 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|