About 2-(1H-indol-3-yl)ethyl 2-(1H-indol-3-yl)acetate
2-(1H-indol-3-yl)ethyl 2-(1H-indol-3-yl)acetate (PubChem CID 156582376) has the molecular formula C20H18N2O2
and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)ethyl 2-(1H-indol-3-yl)acetate.
Molecular Properties
| Compound Name | 2-(1H-indol-3-yl)ethyl 2-(1H-indol-3-yl)acetate |
| PubChem CID | 156582376 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-(1H-indol-3-yl)ethyl 2-(1H-indol-3-yl)acetate |
| SMILES | O=C(Cc1c[nH]c2ccccc12)OCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H18N2O2/c23-20(11-15-13-22-19-8-4-2-6-17(15)19)24-10-9-14-12-21-18-7-3-1-5-16(14)18/h1-8,12-13,21-22H,9-11H2 |
| InChIKey | QQJHMUZTCXCFCF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1H-indol-3-yl)ethyl 2-(1H-indol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indol-3-yl)ethyl 2-(1H-indol-3-yl)acetate?
The IUPAC name of 2-(1H-indol-3-yl)ethyl 2-(1H-indol-3-yl)acetate (CID 156582376) is 2-(1H-indol-3-yl)ethyl 2-(1H-indol-3-yl)acetate.
What is the SMILES notation for 2-(1H-indol-3-yl)ethyl 2-(1H-indol-3-yl)acetate?
The canonical SMILES for 2-(1H-indol-3-yl)ethyl 2-(1H-indol-3-yl)acetate is O=C(Cc1c[nH]c2ccccc12)OCCc1c[nH]c2ccccc12.
What is the InChIKey of 2-(1H-indol-3-yl)ethyl 2-(1H-indol-3-yl)acetate?
The InChIKey is QQJHMUZTCXCFCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O2/c23-20(11-15-13-22-19-8-4-2-6-17(15)19)24-10-9-14-12-21-18-7-3-1-5-16(14)18/h1-8,12-13,21-22H,9-11H2.
What are the key properties of 2-(1H-indol-3-yl)ethyl 2-(1H-indol-3-yl)acetate?
2-(1H-indol-3-yl)ethyl 2-(1H-indol-3-yl)acetate has a molecular weight of 318.38 g/mol, XLogP of 3.98, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indol-3-yl)ethyl 2-(1H-indol-3-yl)acetate is sourced from PubChem (CID 156582376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).