C22H28O7 — CID 156582438
butyl (2'R,7R,8R)-7-hydroxy-3,7-dimethyl-2'-[(2S)-2-methylbutanoyl]-6-oxospiro[isochromene-8,3'-oxirane]-2'-carboxylate (PubChem CID 156582438) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is butyl (2'R,7R,8R)-7-hydroxy-3,7-dimethyl-2'-[(2S)-2-methylbutanoyl]-6-oxospiro[isochromene-8,3'-oxirane]-2'-carboxylate.
| Compound Name | butyl (2'R,7R,8R)-7-hydroxy-3,7-dimethyl-2'-[(2S)-2-methylbutanoyl]-6-oxospiro[isochromene-8,3'-oxirane]-2'-carboxylate |
|---|---|
| PubChem CID | 156582438 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | butyl (2'R,7R,8R)-7-hydroxy-3,7-dimethyl-2'-[(2S)-2-methylbutanoyl]-6-oxospiro[isochromene-8,3'-oxirane]-2'-carboxylate |
| SMILES | CCCCOC(=O)[C@@]1(C(=O)[C@@H](C)CC)O[C@@]12C1=COC(C)=CC1=CC(=O)[C@]2(C)O |
| InChI | InChI=1S/C22H28O7/c1-6-8-9-27-19(25)21(18(24)13(3)7-2)22(29-21)16-12-28-14(4)10-15(16)11-17(23)20(22,5)26/h10-13,26H,6-9H2,1-5H3/t13-,20-,21+,22+/m0/s1 |
| InChIKey | DGWZNXVWPPDPOP-KZPWJOJVSA-N |
| XLogP | 2.53 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|