C16H26O4 — CID 156582444
(E,2S,4R)-6-[(2R,5R)-5-acetyl-5-methyloxolan-2-yl]-2,4-dimethylhept-5-enoic acid (PubChem CID 156582444) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (E,2S,4R)-6-[(2R,5R)-5-acetyl-5-methyloxolan-2-yl]-2,4-dimethylhept-5-enoic acid.
| Compound Name | (E,2S,4R)-6-[(2R,5R)-5-acetyl-5-methyloxolan-2-yl]-2,4-dimethylhept-5-enoic acid |
|---|---|
| PubChem CID | 156582444 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (E,2S,4R)-6-[(2R,5R)-5-acetyl-5-methyloxolan-2-yl]-2,4-dimethylhept-5-enoic acid |
| SMILES | CC(=O)[C@@]1(C)CC[C@H](/C(C)=C/[C@H](C)C[C@H](C)C(=O)O)O1 |
| InChI | InChI=1S/C16H26O4/c1-10(9-12(3)15(18)19)8-11(2)14-6-7-16(5,20-14)13(4)17/h8,10,12,14H,6-7,9H2,1-5H3,(H,18,19)/b11-8+/t10-,12-,14+,16+/m0/s1 |
| InChIKey | RQMATXOEBLWDAQ-AXXXBYNLSA-N |
| XLogP | 3.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|