C16H24O3 — CID 156582451
methyl 3-[(1S,2S,6S,8aR)-6-(hydroxymethyl)-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]propanoate (PubChem CID 156582451) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is methyl 3-[(1S,2S,6S,8aR)-6-(hydroxymethyl)-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]propanoate.
| Compound Name | methyl 3-[(1S,2S,6S,8aR)-6-(hydroxymethyl)-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]propanoate |
|---|---|
| PubChem CID | 156582451 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | methyl 3-[(1S,2S,6S,8aR)-6-(hydroxymethyl)-2-methyl-1,2,6,7,8,8a-hexahydronaphthalen-1-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1[C@@H](C)C=CC2=C[C@@H](CO)CC[C@@H]21 |
| InChI | InChI=1S/C16H24O3/c1-11-3-5-13-9-12(10-17)4-6-15(13)14(11)7-8-16(18)19-2/h3,5,9,11-12,14-15,17H,4,6-8,10H2,1-2H3/t11-,12-,14-,15-/m0/s1 |
| InChIKey | TWKWQPCZOCTTBS-JURCDPSOSA-N |
| XLogP | 2.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |