C13H18O2 — CID 156582495
(3E,5Z,8S,10E)-8-hydroxytrideca-3,5,10,12-tetraen-2-one (PubChem CID 156582495) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (3E,5Z,8S,10E)-8-hydroxytrideca-3,5,10,12-tetraen-2-one.
| Compound Name | (3E,5Z,8S,10E)-8-hydroxytrideca-3,5,10,12-tetraen-2-one |
|---|---|
| PubChem CID | 156582495 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (3E,5Z,8S,10E)-8-hydroxytrideca-3,5,10,12-tetraen-2-one |
| SMILES | C=C/C=C/C[C@H](O)C/C=C\C=C\C(C)=O |
| InChI | InChI=1S/C13H18O2/c1-3-4-6-10-13(15)11-8-5-7-9-12(2)14/h3-9,13,15H,1,10-11H2,2H3/b6-4+,8-5-,9-7+/t13-/m0/s1 |
| InChIKey | WLKGLBGVBUEPDA-IGGQVBTJSA-N |
| XLogP | 2.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|