C21H28O7 — CID 156582564
3-[(7S,8S,8aR)-8-[(2S,4S)-2,4-dimethylhexanoyl]oxy-7-hydroxy-7-methyl-6-oxo-8,8a-dihydro-1H-isochromen-3-yl]prop-2-enoic acid (PubChem CID 156582564) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is 3-[(7S,8S,8aR)-8-[(2S,4S)-2,4-dimethylhexanoyl]oxy-7-hydroxy-7-methyl-6-oxo-8,8a-dihydro-1H-isochromen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[(7S,8S,8aR)-8-[(2S,4S)-2,4-dimethylhexanoyl]oxy-7-hydroxy-7-methyl-6-oxo-8,8a-dihydro-1H-isochromen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 156582564 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 3-[(7S,8S,8aR)-8-[(2S,4S)-2,4-dimethylhexanoyl]oxy-7-hydroxy-7-methyl-6-oxo-8,8a-dihydro-1H-isochromen-3-yl]prop-2-enoic acid |
| SMILES | CC[C@H](C)C[C@H](C)C(=O)O[C@H]1[C@H]2COC(C=CC(=O)O)=CC2=CC(=O)[C@@]1(C)O |
| InChI | InChI=1S/C21H28O7/c1-5-12(2)8-13(3)20(25)28-19-16-11-27-15(6-7-18(23)24)9-14(16)10-17(22)21(19,4)26/h6-7,9-10,12-13,16,19,26H,5,8,11H2,1-4H3,(H,23,24)/t12-,13-,16-,19-,21+/m0/s1 |
| InChIKey | BABRVDYMEWNGHT-KWHVVNMYSA-N |
| XLogP | 2.40 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|