C15H22O3 — CID 156582658
(1R,2S,4S,8S,9R)-8-(hydroxymethyl)-4-methyl-1-prop-1-en-2-yl-11-oxatricyclo[6.2.1.04,9]undec-6-en-2-ol (PubChem CID 156582658) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1R,2S,4S,8S,9R)-8-(hydroxymethyl)-4-methyl-1-prop-1-en-2-yl-11-oxatricyclo[6.2.1.04,9]undec-6-en-2-ol.
| Compound Name | (1R,2S,4S,8S,9R)-8-(hydroxymethyl)-4-methyl-1-prop-1-en-2-yl-11-oxatricyclo[6.2.1.04,9]undec-6-en-2-ol |
|---|---|
| PubChem CID | 156582658 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1R,2S,4S,8S,9R)-8-(hydroxymethyl)-4-methyl-1-prop-1-en-2-yl-11-oxatricyclo[6.2.1.04,9]undec-6-en-2-ol |
| SMILES | C=C(C)[C@@]12C[C@@H]3[C@@](C)(CC=C[C@]3(CO)O1)C[C@@H]2O |
| InChI | InChI=1S/C15H22O3/c1-10(2)15-7-11-13(3,8-12(15)17)5-4-6-14(11,9-16)18-15/h4,6,11-12,16-17H,1,5,7-9H2,2-3H3/t11-,12+,13+,14-,15-/m1/s1 |
| InChIKey | GUWGITAYEAJOST-GZBLMMOJSA-N |
| XLogP | 1.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|