C19H28O5 — CID 156582702
(3S,6S,7S)-3-butan-2-yl-6-(3-hydroxybutan-2-yl)-12-methyl-2,4,11-trioxatricyclo[7.4.0.03,7]trideca-1(9),12-dien-10-one (PubChem CID 156582702) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is (3S,6S,7S)-3-butan-2-yl-6-(3-hydroxybutan-2-yl)-12-methyl-2,4,11-trioxatricyclo[7.4.0.03,7]trideca-1(9),12-dien-10-one.
| Compound Name | (3S,6S,7S)-3-butan-2-yl-6-(3-hydroxybutan-2-yl)-12-methyl-2,4,11-trioxatricyclo[7.4.0.03,7]trideca-1(9),12-dien-10-one |
|---|---|
| PubChem CID | 156582702 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (3S,6S,7S)-3-butan-2-yl-6-(3-hydroxybutan-2-yl)-12-methyl-2,4,11-trioxatricyclo[7.4.0.03,7]trideca-1(9),12-dien-10-one |
| SMILES | CCC(C)[C@@]12OC[C@@H](C(C)C(C)O)[C@@H]1Cc1c(cc(C)oc1=O)O2 |
| InChI | InChI=1S/C19H28O5/c1-6-10(2)19-16(15(9-22-19)12(4)13(5)20)8-14-17(24-19)7-11(3)23-18(14)21/h7,10,12-13,15-16,20H,6,8-9H2,1-5H3/t10?,12?,13?,15-,16-,19-/m0/s1 |
| InChIKey | KFGVAOTZLKUXAN-HSGQKLQUSA-N |
| XLogP | 2.91 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |