C16H20O2 — CID 156582752
(2E,4E,6E,8E,10E,12R,14Z)-12-hydroxyhexadeca-2,4,6,8,10,14-hexaenal (PubChem CID 156582752) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12R,14Z)-12-hydroxyhexadeca-2,4,6,8,10,14-hexaenal.
| Compound Name | (2E,4E,6E,8E,10E,12R,14Z)-12-hydroxyhexadeca-2,4,6,8,10,14-hexaenal |
|---|---|
| PubChem CID | 156582752 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (2E,4E,6E,8E,10E,12R,14Z)-12-hydroxyhexadeca-2,4,6,8,10,14-hexaenal |
| SMILES | C/C=C\C[C@@H](O)/C=C/C=C/C=C/C=C/C=C/C=O |
| InChI | InChI=1S/C16H20O2/c1-2-3-13-16(18)14-11-9-7-5-4-6-8-10-12-15-17/h2-12,14-16,18H,13H2,1H3/b3-2-,5-4+,8-6+,9-7+,12-10+,14-11+/t16-/m1/s1 |
| InChIKey | AZDQNNZNJNMHIY-RQAHAVOJSA-N |
| XLogP | 3.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|