C18H29N3O4 — CID 156582756
(2S)-4-(4-acetamidocyclohexa-2,5-dien-1-yl)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]butanoic acid (PubChem CID 156582756) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is (2S)-4-(4-acetamidocyclohexa-2,5-dien-1-yl)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]butanoic acid.
| Compound Name | (2S)-4-(4-acetamidocyclohexa-2,5-dien-1-yl)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 156582756 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (2S)-4-(4-acetamidocyclohexa-2,5-dien-1-yl)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]butanoic acid |
| SMILES | CN[C@H](C(=O)N[C@@H](CCC1C=CC(NC(C)=O)C=C1)C(=O)O)C(C)C |
| InChI | InChI=1S/C18H29N3O4/c1-11(2)16(19-4)17(23)21-15(18(24)25)10-7-13-5-8-14(9-6-13)20-12(3)22/h5-6,8-9,11,13-16,19H,7,10H2,1-4H3,(H,20,22)(H,21,23)(H,24,25)/t13?,14?,15-,16-/m0/s1 |
| InChIKey | SOFSTVNBQFOELD-CKUJCDMFSA-N |
| XLogP | 0.83 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|