C25H36O8 — CID 156582766
[(1R)-1-[(1S,3R,4R,5R,6R,7S,8R,11S,13S,16S,17R,18E)-4,6-dihydroxy-13-methoxy-5,17,19-trimethyl-14-oxo-2,15-dioxatetracyclo[9.8.0.01,7.03,8]nonadeca-9,18-dien-16-yl]ethyl] acetate (PubChem CID 156582766) has the molecular formula C25H36O8 and a molecular weight of 464.56 g/mol. Its IUPAC name is [(1R)-1-[(1S,3R,4R,5R,6R,7S,8R,11S,13S,16S,17R,18E)-4,6-dihydroxy-13-methoxy-5,17,19-trimethyl-14-oxo-2,15-dioxatetracyclo[9.8.0.01,7.03,8]nonadeca-9,18-dien-16-yl]ethyl] acetate.
| Compound Name | [(1R)-1-[(1S,3R,4R,5R,6R,7S,8R,11S,13S,16S,17R,18E)-4,6-dihydroxy-13-methoxy-5,17,19-trimethyl-14-oxo-2,15-dioxatetracyclo[9.8.0.01,7.03,8]nonadeca-9,18-dien-16-yl]ethyl] acetate |
|---|---|
| PubChem CID | 156582766 |
| Molecular Formula | C25H36O8 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | [(1R)-1-[(1S,3R,4R,5R,6R,7S,8R,11S,13S,16S,17R,18E)-4,6-dihydroxy-13-methoxy-5,17,19-trimethyl-14-oxo-2,15-dioxatetracyclo[9.8.0.01,7.03,8]nonadeca-9,18-dien-16-yl]ethyl] acetate |
| SMILES | CO[C@H]1C[C@H]2C=C[C@H]3[C@H]4O[C@]2(/C(C)=C/[C@@H](C)[C@@H]([C@@H](C)OC(C)=O)OC1=O)[C@@H]3[C@H](O)[C@@H](C)[C@H]4O |
| InChI | InChI=1S/C25H36O8/c1-11-9-12(2)25-16(7-8-17-19(25)20(27)13(3)21(28)23(17)33-25)10-18(30-6)24(29)32-22(11)14(4)31-15(5)26/h7-9,11,13-14,16-23,27-28H,10H2,1-6H3/b12-9+/t11-,13-,14-,16-,17-,18+,19+,20-,21-,22+,23-,25+/m1/s1 |
| InChIKey | IKCHJTKUZUTFGL-AKDNBQDSSA-N |
| XLogP | 1.78 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|