C22H30O4 — CID 156582797
3-ethyl-4-hydroxy-6-[(2S,3R,4S,5E,7Z,10E)-3-hydroxy-4,8-dimethyltrideca-5,7,10,12-tetraen-2-yl]pyran-2-one (PubChem CID 156582797) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is 3-ethyl-4-hydroxy-6-[(2S,3R,4S,5E,7Z,10E)-3-hydroxy-4,8-dimethyltrideca-5,7,10,12-tetraen-2-yl]pyran-2-one.
| Compound Name | 3-ethyl-4-hydroxy-6-[(2S,3R,4S,5E,7Z,10E)-3-hydroxy-4,8-dimethyltrideca-5,7,10,12-tetraen-2-yl]pyran-2-one |
|---|---|
| PubChem CID | 156582797 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 3-ethyl-4-hydroxy-6-[(2S,3R,4S,5E,7Z,10E)-3-hydroxy-4,8-dimethyltrideca-5,7,10,12-tetraen-2-yl]pyran-2-one |
| SMILES | C=C/C=C/C/C(C)=C\C=C\[C@H](C)[C@@H](O)[C@H](C)c1cc(O)c(CC)c(=O)o1 |
| InChI | InChI=1S/C22H30O4/c1-6-8-9-11-15(3)12-10-13-16(4)21(24)17(5)20-14-19(23)18(7-2)22(25)26-20/h6,8-10,12-14,16-17,21,23-24H,1,7,11H2,2-5H3/b9-8+,13-10+,15-12-/t16-,17+,21+/m0/s1 |
| InChIKey | OYGZQEYDCNZTEN-LYALJFTLSA-N |
| XLogP | 4.64 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|