C28H38O5 — CID 156582808
(1S,3S,6S,8S,14R,15E,19E)-6-ethyl-14-methoxy-1,3,5,15,19-pentamethyl-9,21-dioxatetracyclo[9.9.2.03,8.08,22]docosa-4,11(22),15,19-tetraene-10,12-dione (PubChem CID 156582808) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is (1S,3S,6S,8S,14R,15E,19E)-6-ethyl-14-methoxy-1,3,5,15,19-pentamethyl-9,21-dioxatetracyclo[9.9.2.03,8.08,22]docosa-4,11(22),15,19-tetraene-10,12-dione.
| Compound Name | (1S,3S,6S,8S,14R,15E,19E)-6-ethyl-14-methoxy-1,3,5,15,19-pentamethyl-9,21-dioxatetracyclo[9.9.2.03,8.08,22]docosa-4,11(22),15,19-tetraene-10,12-dione |
|---|---|
| PubChem CID | 156582808 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | (1S,3S,6S,8S,14R,15E,19E)-6-ethyl-14-methoxy-1,3,5,15,19-pentamethyl-9,21-dioxatetracyclo[9.9.2.03,8.08,22]docosa-4,11(22),15,19-tetraene-10,12-dione |
| SMILES | CC[C@H]1C[C@@]23OC(=O)C4=C2O[C@](C)(/C=C(/C)CC/C=C(/C)[C@H](OC)CC4=O)C[C@@]3(C)C=C1C |
| InChI | InChI=1S/C28H38O5/c1-8-20-15-28-24-23(25(30)33-28)21(29)12-22(31-7)18(3)11-9-10-17(2)13-27(6,32-24)16-26(28,5)14-19(20)4/h11,13-14,20,22H,8-10,12,15-16H2,1-7H3/b17-13-,18-11-/t20-,22+,26+,27+,28+/m0/s1 |
| InChIKey | IEIODNSVYIVJHJ-NIVMAJRKSA-N |
| XLogP | 5.76 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|